rgd peptide molecular weight RGD Peptides - revox-serum-peptide Molecular weight Unraveling the Molecular Weight of RGD Peptides: A Comprehensive Guide

rgds-peptide The RGD peptide, a short amino acid sequence comprising Arginine-Glycine-Aspartic acid, plays a crucial role in cell adhesion and signaling. Understanding its molecular weight is fundamental for researchers and scientists working with this versatile biomolecule. This article delves into the various molecular weights associated with different forms of RGD peptides, exploring the factors that influence these values and providing verifiable information for scientific applications.

The RGD sequence itself, a tripeptide, has a well-defined molecular weight. Based on its chemical composition (Formula C12H22N6O6), the molecular weight of the basic RGD peptide is approximately 346.34 g/mol. This value is consistently reported across various scientific databases and supplier information, serving as a baseline for understanding this significant peptide. This fundamental tripeptide is often referred to as H-RGD-OH.RGD (Arg-Gly-Asp) Peptides

However, the world of RGD peptides extends beyond this simple tripeptide.RGD peptide | CRB1001012 Researchers often utilize modified or longer peptide sequences incorporating the RGD motif to enhance targeting capabilities or study specific biological interactions. This leads to variations in the molecular weight. For instance, a commonly studied RGD peptide known as GRGDNP exhibits a Molecular Weight, 614.61. This particular RGD peptide is recognized for its role as an integrin inhibitor, highlighting the functional significance of its specific sequence and resulting molecular weight. Another example is the RGD peptide (GRGDNP) (TFA), which has a Molecular Weight: 728.63, likely due to the addition of a trifluoroacetic acid (TFA) salt.

The structure of the RGD peptide can also influence its molecular weight. Cyclic forms of RGD peptides, such as cyclic RGD (with a Molecular Weight of 612.7 g/mol) or Cyclo (RGDfC) (with a Molecular Mass/Weight of 578.7), involve a covalent bond that closes the peptide chain.RGD-Substituted High Molecular Weight Hyper-Branched ... This cyclization alters the overall molecular weight and can significantly impact the peptide's stability and binding affinity to its target receptors, particularly integrins.RGD (Arg-Gly-Asp) Peptides The molecule itself, in its various forms, is a subject of extensive research.

Furthermore, the context in which the RGD peptide is presented can affect its stated molecular weight. For example, when conjugated to other molecules or polymers, the overall molecular weight will increase substantially. Studies have explored RGD-Substituted High Molecular Weight Hyper-Branched Polymers, indicating that the molecular weights of these conjugates can vary widely depending on the polymer backbone and the degree of RGD substitutionPeptide Calculator - Bachem. Similarly, research on RGD peptide-based materials may report on polymers with a range of molecular weights, such as those with low dispersity and precise chain ends, as seen in studies involving RAFT polymerization.Cyclo (RGDfC), avb3 Integrin Binding Cyclic RGD Peptide

For accurate scientific work, it is crucial to consult the specific product information or research paper detailing the exact RGD peptide sequence and any modifications.RGD peptide(GRGDNP) (TFA). CAS No. :Molecular Weight: 728.63. Purity/ Specification :Molecular Formula: C25H39F3N10O12, Storage : -. SMILES Code: O=C(O)[C ... The Molecular Formula is a key piece of information that directly determines the molecular weight. For the basic RGD peptide, the Formula is C12H22N6O6, leading to the 346RGD peptide(GRGDNP) ; Catalog Num, A22271 ; Formula, C23H38N10O10 ;Molecular Weight, 614.61 ; CAS Number, 114681-65-1 ; SMILES, NCC(N[C@@H](CCCNC(N)=N)C(NCC(N[C@@H]( ....34 valueMolecular Weight. 346.34 g/mol. Computed by PubChem 2.2 (PubChem release 2025.09.15) ; IUPAC Condensed. H-DL-Arg-Gly-DL-Asp-OH ; Sequence.RGD; PLN. H-RGD-OH.. For the GRGDNP sequence, the Molecular Formula is often cited as C23H38N10O10, corresponding to the Molecular Weight: 614Product Description ; Shipping Type, Blue ice ; Storage, -20°C ; SMILES Code. C(CC(C(=O)NCC(=O)NC(CC(=O)O)C(=O)O)N)CN=C(N)N ;Molecular Weight. 346.34 ; Formula..61.

In summary, while the foundational RGD peptide has a molecular weight of 346.34 g/mol, the actual molecular weight of RGD peptides can vary significantly based on modifications, cyclization, conjugation, and the presence of counterions. Understanding these variations is essential for precise experimental design and accurate interpretation of results in fields ranging from cell biology to drug delivery and biomaterials science(b) Mass spectrometry of RGD peptide Molecular weight of RGD peptide (Fmoc‐Phe‐Phe‐Gly‐Gly‐Arg‐Gly‐Asp) is 977.05. Tenon's capsule fibroblasts are the main .... The exploration of RGD peptides continues to expand, underscoring the importance of detailed knowledge regarding their chemical properties, including their molecular weights.Ala-Ala-Phe-CH2Cl · IAA-3202-V · CAS No: 102129-66-8. Chemical Formula: C16H22N3O3Cl.Molecular Weight: 339.82 g/mol ; Alarelin · HOR-291 ; Antipain · IAP-4062. CAS ...